C37H50BrN3O4 — CID 19933508
2-(8-bromooctyl)isoindole-1,3-dione;2-(8-piperidin-1-yloctyl)isoindole-1,3-dione (PubChem CID 19933508) has the molecular formula C37H50BrN3O4 and a molecular weight of 680.73 g/mol. Its IUPAC name is 2-(8-bromooctyl)isoindole-1,3-dione;2-(8-piperidin-1-yloctyl)isoindole-1,3-dione.
| Compound Name | 2-(8-bromooctyl)isoindole-1,3-dione;2-(8-piperidin-1-yloctyl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 19933508 |
| Molecular Formula | C37H50BrN3O4 |
| Molecular Weight | 680.73 g/mol |
| Exact Mass | 679.30 |
| IUPAC Name | 2-(8-bromooctyl)isoindole-1,3-dione;2-(8-piperidin-1-yloctyl)isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1CCCCCCCCBr.O=C1c2ccccc2C(=O)N1CCCCCCCCN1CCCCC1 |
| InChI | InChI=1S/C21H30N2O2.C16H20BrNO2/c24-20-18-12-6-7-13-19(18)21(25)23(20)17-11-4-2-1-3-8-14-22-15-9-5-10-16-22;17-11-7-3-1-2-4-8-12-18-15(19)13-9-5-6-10-14(13)16(18)20/h6-7,12-13H,1-5,8-11,14-17H2;5-6,9-10H,1-4,7-8,11-12H2 |
| InChIKey | RRVJVAKLLGDVDH-UHFFFAOYSA-N |
| XLogP | 8.13 |
| TPSA | 78.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.73 |
| LogP ≤ 5 | 8.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|