C24H25BrN2O4 — CID 67624782
2-(8-bromooctyl)isoindole-1,3-dione;isoindole-1,3-dione (PubChem CID 67624782) has the molecular formula C24H25BrN2O4 and a molecular weight of 485.38 g/mol. Its IUPAC name is 2-(8-bromooctyl)isoindole-1,3-dione;isoindole-1,3-dione.
| Compound Name | 2-(8-bromooctyl)isoindole-1,3-dione;isoindole-1,3-dione |
|---|---|
| PubChem CID | 67624782 |
| Molecular Formula | C24H25BrN2O4 |
| Molecular Weight | 485.38 g/mol |
| Exact Mass | 484.10 |
| IUPAC Name | 2-(8-bromooctyl)isoindole-1,3-dione;isoindole-1,3-dione |
| SMILES | O=C1NC(=O)c2ccccc21.O=C1c2ccccc2C(=O)N1CCCCCCCCBr |
| InChI | InChI=1S/C16H20BrNO2.C8H5NO2/c17-11-7-3-1-2-4-8-12-18-15(19)13-9-5-6-10-14(13)16(18)20;10-7-5-3-1-2-4-6(5)8(11)9-7/h5-6,9-10H,1-4,7-8,11-12H2;1-4H,(H,9,10,11) |
| InChIKey | WADXIJJUPKIEEJ-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.38 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|