C17H15Br2NO2 — CID 71592235
6-bromo-2-(5-bromopentyl)benzo[de]isoquinoline-1,3-dione (PubChem CID 71592235) has the molecular formula C17H15Br2NO2 and a molecular weight of 425.12 g/mol. Its IUPAC name is 6-bromo-2-(5-bromopentyl)benzo[de]isoquinoline-1,3-dione.
| Compound Name | 6-bromo-2-(5-bromopentyl)benzo[de]isoquinoline-1,3-dione |
|---|---|
| PubChem CID | 71592235 |
| Molecular Formula | C17H15Br2NO2 |
| Molecular Weight | 425.12 g/mol |
| Exact Mass | 422.95 |
| IUPAC Name | 6-bromo-2-(5-bromopentyl)benzo[de]isoquinoline-1,3-dione |
| SMILES | O=C1c2cccc3c(Br)ccc(c23)C(=O)N1CCCCCBr |
| InChI | InChI=1S/C17H15Br2NO2/c18-9-2-1-3-10-20-16(21)12-6-4-5-11-14(19)8-7-13(15(11)12)17(20)22/h4-8H,1-3,9-10H2 |
| InChIKey | RKQGCVSLRXCXRV-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.12 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|