C21H26BrNO5Si — CID 102165860
6-bromo-2-(3-triethoxysilylpropyl)benzo[de]isoquinoline-1,3-dione (PubChem CID 102165860) has the molecular formula C21H26BrNO5Si and a molecular weight of 480.43 g/mol. Its IUPAC name is 6-bromo-2-(3-triethoxysilylpropyl)benzo[de]isoquinoline-1,3-dione.
| Compound Name | 6-bromo-2-(3-triethoxysilylpropyl)benzo[de]isoquinoline-1,3-dione |
|---|---|
| PubChem CID | 102165860 |
| Molecular Formula | C21H26BrNO5Si |
| Molecular Weight | 480.43 g/mol |
| Exact Mass | 479.08 |
| IUPAC Name | 6-bromo-2-(3-triethoxysilylpropyl)benzo[de]isoquinoline-1,3-dione |
| SMILES | CCO[Si](CCCN1C(=O)c2cccc3c(Br)ccc(c23)C1=O)(OCC)OCC |
| InChI | InChI=1S/C21H26BrNO5Si/c1-4-26-29(27-5-2,28-6-3)14-8-13-23-20(24)16-10-7-9-15-18(22)12-11-17(19(15)16)21(23)25/h7,9-12H,4-6,8,13-14H2,1-3H3 |
| InChIKey | QHXKJOJHZOMELK-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.43 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|