C24H31N5O5Si — CID 54578791
6-amino-2-[[1-(3-triethoxysilylpropyl)triazol-4-yl]methyl]benzo[de]isoquinoline-1,3-dione (PubChem CID 54578791) has the molecular formula C24H31N5O5Si and a molecular weight of 497.63 g/mol. Its IUPAC name is 6-amino-2-[[1-(3-triethoxysilylpropyl)triazol-4-yl]methyl]benzo[de]isoquinoline-1,3-dione.
| Compound Name | 6-amino-2-[[1-(3-triethoxysilylpropyl)triazol-4-yl]methyl]benzo[de]isoquinoline-1,3-dione |
|---|---|
| PubChem CID | 54578791 |
| Molecular Formula | C24H31N5O5Si |
| Molecular Weight | 497.63 g/mol |
| Exact Mass | 497.21 |
| IUPAC Name | 6-amino-2-[[1-(3-triethoxysilylpropyl)triazol-4-yl]methyl]benzo[de]isoquinoline-1,3-dione |
| SMILES | CCO[Si](CCCn1cc(CN2C(=O)c3cccc4c(N)ccc(c34)C2=O)nn1)(OCC)OCC |
| InChI | InChI=1S/C24H31N5O5Si/c1-4-32-35(33-5-2,34-6-3)14-8-13-28-15-17(26-27-28)16-29-23(30)19-10-7-9-18-21(25)12-11-20(22(18)19)24(29)31/h7,9-12,15H,4-6,8,13-14,16,25H2,1-3H3 |
| InChIKey | HOWUECPMGVZEHD-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 121.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.63 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|