C16H23NO5Si — CID 19362095
2-(2-triethoxysilylethyl)isoindole-1,3-dione (PubChem CID 19362095) has the molecular formula C16H23NO5Si and a molecular weight of 337.45 g/mol. Its IUPAC name is 2-(2-triethoxysilylethyl)isoindole-1,3-dione.
| Compound Name | 2-(2-triethoxysilylethyl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 19362095 |
| Molecular Formula | C16H23NO5Si |
| Molecular Weight | 337.45 g/mol |
| Exact Mass | 337.13 |
| IUPAC Name | 2-(2-triethoxysilylethyl)isoindole-1,3-dione |
| SMILES | CCO[Si](CCN1C(=O)c2ccccc2C1=O)(OCC)OCC |
| InChI | InChI=1S/C16H23NO5Si/c1-4-20-23(21-5-2,22-6-3)12-11-17-15(18)13-9-7-8-10-14(13)16(17)19/h7-10H,4-6,11-12H2,1-3H3 |
| InChIKey | ADPCHFGHDSDHEF-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.45 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|