C12H13ClNO4P — CID 102021164
2-[2-[chloro(ethoxy)phosphoryl]ethyl]isoindole-1,3-dione (PubChem CID 102021164) has the molecular formula C12H13ClNO4P and a molecular weight of 301.67 g/mol. Its IUPAC name is 2-[2-[chloro(ethoxy)phosphoryl]ethyl]isoindole-1,3-dione.
| Compound Name | 2-[2-[chloro(ethoxy)phosphoryl]ethyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 102021164 |
| Molecular Formula | C12H13ClNO4P |
| Molecular Weight | 301.67 g/mol |
| Exact Mass | 301.03 |
| IUPAC Name | 2-[2-[chloro(ethoxy)phosphoryl]ethyl]isoindole-1,3-dione |
| SMILES | CCOP(=O)(Cl)CCN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C12H13ClNO4P/c1-2-18-19(13,17)8-7-14-11(15)9-5-3-4-6-10(9)12(14)16/h3-6H,2,7-8H2,1H3 |
| InChIKey | QLETUDGPMWBOLV-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.67 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|