C25H27N2O6P — CID 11869157
2-[4-[4-(1,3-dioxoisoindol-2-yl)butyl-methylphosphoryl]oxybutyl]isoindole-1,3-dione (PubChem CID 11869157) has the molecular formula C25H27N2O6P and a molecular weight of 482.47 g/mol. Its IUPAC name is 2-[4-[4-(1,3-dioxoisoindol-2-yl)butyl-methylphosphoryl]oxybutyl]isoindole-1,3-dione.
| Compound Name | 2-[4-[4-(1,3-dioxoisoindol-2-yl)butyl-methylphosphoryl]oxybutyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 11869157 |
| Molecular Formula | C25H27N2O6P |
| Molecular Weight | 482.47 g/mol |
| Exact Mass | 482.16 |
| IUPAC Name | 2-[4-[4-(1,3-dioxoisoindol-2-yl)butyl-methylphosphoryl]oxybutyl]isoindole-1,3-dione |
| SMILES | C[P@](=O)(CCCCN1C(=O)c2ccccc2C1=O)OCCCCN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C25H27N2O6P/c1-34(32,17-9-7-15-27-24(30)20-12-4-5-13-21(20)25(27)31)33-16-8-6-14-26-22(28)18-10-2-3-11-19(18)23(26)29/h2-5,10-13H,6-9,14-17H2,1H3/t34-/m1/s1 |
| InChIKey | YCYHQRJUQUTZHN-UUWRZZSWSA-N |
| XLogP | 4.06 |
| TPSA | 101.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.47 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|