C18H25ClNO5P — CID 21065212
2-[5-[(3-chloro-2-hydroxypropyl)-ethoxyphosphoryl]pentyl]isoindole-1,3-dione (PubChem CID 21065212) has the molecular formula C18H25ClNO5P and a molecular weight of 401.83 g/mol. Its IUPAC name is 2-[5-[(3-chloro-2-hydroxypropyl)-ethoxyphosphoryl]pentyl]isoindole-1,3-dione.
| Compound Name | 2-[5-[(3-chloro-2-hydroxypropyl)-ethoxyphosphoryl]pentyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 21065212 |
| Molecular Formula | C18H25ClNO5P |
| Molecular Weight | 401.83 g/mol |
| Exact Mass | 401.12 |
| IUPAC Name | 2-[5-[(3-chloro-2-hydroxypropyl)-ethoxyphosphoryl]pentyl]isoindole-1,3-dione |
| SMILES | CCOP(=O)(CCCCCN1C(=O)c2ccccc2C1=O)CC(O)CCl |
| InChI | InChI=1S/C18H25ClNO5P/c1-2-25-26(24,13-14(21)12-19)11-7-3-6-10-20-17(22)15-8-4-5-9-16(15)18(20)23/h4-5,8-9,14,21H,2-3,6-7,10-13H2,1H3 |
| InChIKey | QBETZBBBMCIGFL-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.83 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|