C23H38N5O4P — CID 59865445
2-[4-[ethoxy(1,4,7,10-tetrazacyclododec-1-ylmethyl)phosphoryl]butyl]isoindole-1,3-dione (PubChem CID 59865445) has the molecular formula C23H38N5O4P and a molecular weight of 479.56 g/mol. Its IUPAC name is 2-[4-[ethoxy(1,4,7,10-tetrazacyclododec-1-ylmethyl)phosphoryl]butyl]isoindole-1,3-dione.
| Compound Name | 2-[4-[ethoxy(1,4,7,10-tetrazacyclododec-1-ylmethyl)phosphoryl]butyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 59865445 |
| Molecular Formula | C23H38N5O4P |
| Molecular Weight | 479.56 g/mol |
| Exact Mass | 479.27 |
| IUPAC Name | 2-[4-[ethoxy(1,4,7,10-tetrazacyclododec-1-ylmethyl)phosphoryl]butyl]isoindole-1,3-dione |
| SMILES | CCOP(=O)(CCCCN1C(=O)c2ccccc2C1=O)CN1CCNCCNCCNCC1 |
| InChI | InChI=1S/C23H38N5O4P/c1-2-32-33(31,19-27-16-13-25-11-9-24-10-12-26-14-17-27)18-6-5-15-28-22(29)20-7-3-4-8-21(20)23(28)30/h3-4,7-8,24-26H,2,5-6,9-19H2,1H3 |
| InChIKey | UYVXOKAPSUSKKV-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 103.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.56 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|