C32H43N5O6 — CID 143202833
benzyl 5-(1,3-dioxoisoindol-2-yl)-2-[4-(2-ethoxy-2-oxoethyl)-1,4,7,10-tetrazacyclododec-1-yl]pentanoate (PubChem CID 143202833) has the molecular formula C32H43N5O6 and a molecular weight of 593.73 g/mol. Its IUPAC name is benzyl 5-(1,3-dioxoisoindol-2-yl)-2-[4-(2-ethoxy-2-oxoethyl)-1,4,7,10-tetrazacyclododec-1-yl]pentanoate.
| Compound Name | benzyl 5-(1,3-dioxoisoindol-2-yl)-2-[4-(2-ethoxy-2-oxoethyl)-1,4,7,10-tetrazacyclododec-1-yl]pentanoate |
|---|---|
| PubChem CID | 143202833 |
| Molecular Formula | C32H43N5O6 |
| Molecular Weight | 593.73 g/mol |
| Exact Mass | 593.32 |
| IUPAC Name | benzyl 5-(1,3-dioxoisoindol-2-yl)-2-[4-(2-ethoxy-2-oxoethyl)-1,4,7,10-tetrazacyclododec-1-yl]pentanoate |
| SMILES | CCOC(=O)CN1CCNCCNCCN(C(CCCN2C(=O)c3ccccc3C2=O)C(=O)OCc2ccccc2)CC1 |
| InChI | InChI=1S/C32H43N5O6/c1-2-42-29(38)23-35-19-16-33-14-15-34-17-20-36(22-21-35)28(32(41)43-24-25-9-4-3-5-10-25)13-8-18-37-30(39)26-11-6-7-12-27(26)31(37)40/h3-7,9-12,28,33-34H,2,8,13-24H2,1H3 |
| InChIKey | UEADCULFNOPIQL-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 120.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.73 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|