C26H32N4O4 — CID 58232891
benzyl 5-(1,3-dioxoisoindol-2-yl)-2-(1,4,7-triazonan-1-yl)pentanoate (PubChem CID 58232891) has the molecular formula C26H32N4O4 and a molecular weight of 464.57 g/mol. Its IUPAC name is benzyl 5-(1,3-dioxoisoindol-2-yl)-2-(1,4,7-triazonan-1-yl)pentanoate.
| Compound Name | benzyl 5-(1,3-dioxoisoindol-2-yl)-2-(1,4,7-triazonan-1-yl)pentanoate |
|---|---|
| PubChem CID | 58232891 |
| Molecular Formula | C26H32N4O4 |
| Molecular Weight | 464.57 g/mol |
| Exact Mass | 464.24 |
| IUPAC Name | benzyl 5-(1,3-dioxoisoindol-2-yl)-2-(1,4,7-triazonan-1-yl)pentanoate |
| SMILES | O=C(OCc1ccccc1)C(CCCN1C(=O)c2ccccc2C1=O)N1CCNCCNCC1 |
| InChI | InChI=1S/C26H32N4O4/c31-24-21-9-4-5-10-22(21)25(32)30(24)16-6-11-23(29-17-14-27-12-13-28-15-18-29)26(33)34-19-20-7-2-1-3-8-20/h1-5,7-10,23,27-28H,6,11-19H2 |
| InChIKey | ULRVVQTXCSOAEP-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.57 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|