C14H17N3O4 — CID 21152099
2-(1,3-dioxoisoindol-2-yl)acetic acid;piperazine (PubChem CID 21152099) has the molecular formula C14H17N3O4 and a molecular weight of 291.31 g/mol. Its IUPAC name is 2-(1,3-dioxoisoindol-2-yl)acetic acid;piperazine.
| Compound Name | 2-(1,3-dioxoisoindol-2-yl)acetic acid;piperazine |
|---|---|
| PubChem CID | 21152099 |
| Molecular Formula | C14H17N3O4 |
| Molecular Weight | 291.31 g/mol |
| Exact Mass | 291.12 |
| IUPAC Name | 2-(1,3-dioxoisoindol-2-yl)acetic acid;piperazine |
| SMILES | C1CNCCN1.O=C(O)CN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C10H7NO4.C4H10N2/c12-8(13)5-11-9(14)6-3-1-2-4-7(6)10(11)15;1-2-6-4-3-5-1/h1-4H,5H2,(H,12,13);5-6H,1-4H2 |
| InChIKey | GFBDXOMSICCAAP-UHFFFAOYSA-N |
| XLogP | -0.45 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.31 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|