C15H16N2O2 — CID 175288610
2-[2-(azetidin-3-ylidene)butyl]isoindole-1,3-dione (PubChem CID 175288610) has the molecular formula C15H16N2O2 and a molecular weight of 256.31 g/mol. Its IUPAC name is 2-[2-(azetidin-3-ylidene)butyl]isoindole-1,3-dione.
| Compound Name | 2-[2-(azetidin-3-ylidene)butyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 175288610 |
| Molecular Formula | C15H16N2O2 |
| Molecular Weight | 256.31 g/mol |
| Exact Mass | 256.12 |
| IUPAC Name | 2-[2-(azetidin-3-ylidene)butyl]isoindole-1,3-dione |
| SMILES | CCC(CN1C(=O)c2ccccc2C1=O)=C1CNC1 |
| InChI | InChI=1S/C15H16N2O2/c1-2-10(11-7-16-8-11)9-17-14(18)12-5-3-4-6-13(12)15(17)19/h3-6,16H,2,7-9H2,1H3 |
| InChIKey | FSSJNNNCAFZYSG-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.31 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|