C11H11NO2S — CID 13458998
2-(ethylsulfanylmethyl)isoindole-1,3-dione (PubChem CID 13458998) has the molecular formula C11H11NO2S and a molecular weight of 221.28 g/mol. Its IUPAC name is 2-(ethylsulfanylmethyl)isoindole-1,3-dione.
| Compound Name | 2-(ethylsulfanylmethyl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 13458998 |
| Molecular Formula | C11H11NO2S |
| Molecular Weight | 221.28 g/mol |
| Exact Mass | 221.05 |
| IUPAC Name | 2-(ethylsulfanylmethyl)isoindole-1,3-dione |
| SMILES | CCSCN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C11H11NO2S/c1-2-15-7-12-10(13)8-5-3-4-6-9(8)11(12)14/h3-6H,2,7H2,1H3 |
| InChIKey | RRWUPGSUPJJZAO-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.28 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|