C12H12NO3W- — CID 158979735
carbanide;2-(2-oxopropyl)isoindole-1,3-dione;tungsten (PubChem CID 158979735) has the molecular formula C12H12NO3W- and a molecular weight of 402.07 g/mol. Its IUPAC name is carbanide;2-(2-oxopropyl)isoindole-1,3-dione;tungsten.
| Compound Name | carbanide;2-(2-oxopropyl)isoindole-1,3-dione;tungsten |
|---|---|
| PubChem CID | 158979735 |
| Molecular Formula | C12H12NO3W- |
| Molecular Weight | 402.07 g/mol |
| Exact Mass | 402.03 |
| IUPAC Name | carbanide;2-(2-oxopropyl)isoindole-1,3-dione;tungsten |
| SMILES | CC(=O)CN1C(=O)c2ccccc2C1=O.[CH3-].[W] |
| InChI | InChI=1S/C11H9NO3.CH3.W/c1-7(13)6-12-10(14)8-4-2-3-5-9(8)11(12)15;;/h2-5H,6H2,1H3;1H3;/q;-1; |
| InChIKey | XJTSCLYWJDRAJV-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.07 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|