C10H6ClNO3 — CID 11031536
2-(1,3-dioxoisoindol-2-yl)acetyl chloride (PubChem CID 11031536) has the molecular formula C10H6ClNO3 and a molecular weight of 225.60 g/mol. Its IUPAC name is 2-(1,3-dioxoisoindol-2-yl)acetyl chloride.
| Compound Name | 2-(1,3-dioxoisoindol-2-yl)acetyl chloride |
|---|---|
| PubChem CID | 11031536 |
| Molecular Formula | C10H6ClNO3 |
| Molecular Weight | 225.60 g/mol |
| Exact Mass | 225.01 |
| IUPAC Name | 2-(1,3-dioxoisoindol-2-yl)acetyl chloride |
| SMILES | O=C1c2ccccc2C(=O)N1[13CH2][13C](=O)Cl |
| InChI | InChI=1S/C10H6ClNO3/c11-8(13)5-12-9(14)6-3-1-2-4-7(6)10(12)15/h1-4H,5H2/i5+1,8+1 |
| InChIKey | RHZBRCQIKQUQHQ-LXCUQPLXSA-N |
| XLogP | 1.05 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.60 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|