C13H11BrClNO3 — CID 89149120
2-bromo-5-(1,3-dioxoisoindol-2-yl)pentanoyl chloride (PubChem CID 89149120) has the molecular formula C13H11BrClNO3 and a molecular weight of 344.59 g/mol. Its IUPAC name is 2-bromo-5-(1,3-dioxoisoindol-2-yl)pentanoyl chloride.
| Compound Name | 2-bromo-5-(1,3-dioxoisoindol-2-yl)pentanoyl chloride |
|---|---|
| PubChem CID | 89149120 |
| Molecular Formula | C13H11BrClNO3 |
| Molecular Weight | 344.59 g/mol |
| Exact Mass | 342.96 |
| IUPAC Name | 2-bromo-5-(1,3-dioxoisoindol-2-yl)pentanoyl chloride |
| SMILES | O=C(Cl)C(Br)CCCN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C13H11BrClNO3/c14-10(11(15)17)6-3-7-16-12(18)8-4-1-2-5-9(8)13(16)19/h1-2,4-5,10H,3,6-7H2 |
| InChIKey | HWIFQVKWTBRPBH-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.59 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|