C20H21NO3 — CID 58386199
2-(4-hydroxy-6-phenylhexyl)isoindole-1,3-dione (PubChem CID 58386199) has the molecular formula C20H21NO3 and a molecular weight of 323.39 g/mol. Its IUPAC name is 2-(4-hydroxy-6-phenylhexyl)isoindole-1,3-dione.
| Compound Name | 2-(4-hydroxy-6-phenylhexyl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 58386199 |
| Molecular Formula | C20H21NO3 |
| Molecular Weight | 323.39 g/mol |
| Exact Mass | 323.15 |
| IUPAC Name | 2-(4-hydroxy-6-phenylhexyl)isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1CCCC(O)CCc1ccccc1 |
| InChI | InChI=1S/C20H21NO3/c22-16(13-12-15-7-2-1-3-8-15)9-6-14-21-19(23)17-10-4-5-11-18(17)20(21)24/h1-5,7-8,10-11,16,22H,6,9,12-14H2 |
| InChIKey | MNQMBLSUYPOGAF-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.39 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|