C12H14NO6P — CID 118915645
[4-(1,3-dioxoisoindol-2-yl)-1-hydroxybutyl]phosphonic acid (PubChem CID 118915645) has the molecular formula C12H14NO6P and a molecular weight of 299.22 g/mol. Its IUPAC name is [4-(1,3-dioxoisoindol-2-yl)-1-hydroxybutyl]phosphonic acid.
| Compound Name | [4-(1,3-dioxoisoindol-2-yl)-1-hydroxybutyl]phosphonic acid |
|---|---|
| PubChem CID | 118915645 |
| Molecular Formula | C12H14NO6P |
| Molecular Weight | 299.22 g/mol |
| Exact Mass | 299.06 |
| IUPAC Name | [4-(1,3-dioxoisoindol-2-yl)-1-hydroxybutyl]phosphonic acid |
| SMILES | O=C1c2ccccc2C(=O)N1CCCC(O)P(=O)(O)O |
| InChI | InChI=1S/C12H14NO6P/c14-10(20(17,18)19)6-3-7-13-11(15)8-4-1-2-5-9(8)12(13)16/h1-2,4-5,10,14H,3,6-7H2,(H2,17,18,19) |
| InChIKey | BRYZFQQROCOOHF-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 115.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.22 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|