C13H12N4O4 — CID 139702305
2-azido-5-(1,3-dioxoisoindol-2-yl)pentanoic acid (PubChem CID 139702305) has the molecular formula C13H12N4O4 and a molecular weight of 288.26 g/mol. Its IUPAC name is 2-azido-5-(1,3-dioxoisoindol-2-yl)pentanoic acid.
| Compound Name | 2-azido-5-(1,3-dioxoisoindol-2-yl)pentanoic acid |
|---|---|
| PubChem CID | 139702305 |
| Molecular Formula | C13H12N4O4 |
| Molecular Weight | 288.26 g/mol |
| Exact Mass | 288.09 |
| IUPAC Name | 2-azido-5-(1,3-dioxoisoindol-2-yl)pentanoic acid |
| SMILES | [N-]=[N+]=NC(CCCN1C(=O)c2ccccc2C1=O)C(=O)O |
| InChI | InChI=1S/C13H12N4O4/c14-16-15-10(13(20)21)6-3-7-17-11(18)8-4-1-2-5-9(8)12(17)19/h1-2,4-5,10H,3,6-7H2,(H,20,21) |
| InChIKey | LEOYKMIEVXSLQL-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 123.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.26 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|