C14H14FNO4 — CID 142092331
2-fluoroprop-2-enoic acid;2-propylisoindole-1,3-dione (PubChem CID 142092331) has the molecular formula C14H14FNO4 and a molecular weight of 279.27 g/mol. Its IUPAC name is 2-fluoroprop-2-enoic acid;2-propylisoindole-1,3-dione.
| Compound Name | 2-fluoroprop-2-enoic acid;2-propylisoindole-1,3-dione |
|---|---|
| PubChem CID | 142092331 |
| Molecular Formula | C14H14FNO4 |
| Molecular Weight | 279.27 g/mol |
| Exact Mass | 279.09 |
| IUPAC Name | 2-fluoroprop-2-enoic acid;2-propylisoindole-1,3-dione |
| SMILES | C=C(F)C(=O)O.CCCN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C11H11NO2.C3H3FO2/c1-2-7-12-10(13)8-5-3-4-6-9(8)11(12)14;1-2(4)3(5)6/h3-6H,2,7H2,1H3;1H2,(H,5,6) |
| InChIKey | OLVYLEKBKWHAQV-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.27 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|