C12H8FNO4 — CID 121008646
(Z)-4-(1,3-dioxoisoindol-2-yl)-2-fluorobut-2-enoic acid (PubChem CID 121008646) has the molecular formula C12H8FNO4 and a molecular weight of 249.20 g/mol. Its IUPAC name is (Z)-4-(1,3-dioxoisoindol-2-yl)-2-fluorobut-2-enoic acid.
| Compound Name | (Z)-4-(1,3-dioxoisoindol-2-yl)-2-fluorobut-2-enoic acid |
|---|---|
| PubChem CID | 121008646 |
| Molecular Formula | C12H8FNO4 |
| Molecular Weight | 249.20 g/mol |
| Exact Mass | 249.04 |
| IUPAC Name | (Z)-4-(1,3-dioxoisoindol-2-yl)-2-fluorobut-2-enoic acid |
| SMILES | O=C(O)/C(F)=C/CN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C12H8FNO4/c13-9(12(17)18)5-6-14-10(15)7-3-1-2-4-8(7)11(14)16/h1-5H,6H2,(H,17,18)/b9-5- |
| InChIKey | DSYSVFXSTQXNEQ-UITAMQMPSA-N |
| XLogP | 1.22 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.20 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|