C18H21NO2 — CID 13123287
2-[(2Z)-3,7-dimethylocta-2,6-dienyl]isoindole-1,3-dione (PubChem CID 13123287) has the molecular formula C18H21NO2 and a molecular weight of 283.37 g/mol. Its IUPAC name is 2-[(2Z)-3,7-dimethylocta-2,6-dienyl]isoindole-1,3-dione.
| Compound Name | 2-[(2Z)-3,7-dimethylocta-2,6-dienyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 13123287 |
| Molecular Formula | C18H21NO2 |
| Molecular Weight | 283.37 g/mol |
| Exact Mass | 283.16 |
| IUPAC Name | 2-[(2Z)-3,7-dimethylocta-2,6-dienyl]isoindole-1,3-dione |
| SMILES | CC(C)=CCC/C(C)=C\CN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C18H21NO2/c1-13(2)7-6-8-14(3)11-12-19-17(20)15-9-4-5-10-16(15)18(19)21/h4-5,7,9-11H,6,8,12H2,1-3H3/b14-11- |
| InChIKey | NZUXIQHUOLOYNR-KAMYIIQDSA-N |
| XLogP | 3.98 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.37 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|