C28H33ClN2O4 — CID 68540686
4-chloro-1,3,10-trihydroxy-5-(3,7,11-trimethyldodeca-2,6,10-trienyl)-11H-benzo[b][1,4]benzodiazepin-6-one (PubChem CID 68540686) has the molecular formula C28H33ClN2O4 and a molecular weight of 497.04 g/mol. Its IUPAC name is 4-chloro-1,3,10-trihydroxy-5-(3,7,11-trimethyldodeca-2,6,10-trienyl)-11H-benzo[b][1,4]benzodiazepin-6-one.
| Compound Name | 4-chloro-1,3,10-trihydroxy-5-(3,7,11-trimethyldodeca-2,6,10-trienyl)-11H-benzo[b][1,4]benzodiazepin-6-one |
|---|---|
| PubChem CID | 68540686 |
| Molecular Formula | C28H33ClN2O4 |
| Molecular Weight | 497.04 g/mol |
| Exact Mass | 496.21 |
| IUPAC Name | 4-chloro-1,3,10-trihydroxy-5-(3,7,11-trimethyldodeca-2,6,10-trienyl)-11H-benzo[b][1,4]benzodiazepin-6-one |
| SMILES | CC(C)=CCCC(C)=CCCC(C)=CCN1C(=O)c2cccc(O)c2Nc2c(O)cc(O)c(Cl)c21 |
| InChI | InChI=1S/C28H33ClN2O4/c1-17(2)8-5-9-18(3)10-6-11-19(4)14-15-31-27-24(29)22(33)16-23(34)26(27)30-25-20(28(31)35)12-7-13-21(25)32/h7-8,10,12-14,16,30,32-34H,5-6,9,11,15H2,1-4H3 |
| InChIKey | CHYPLVPNLSOSEZ-UHFFFAOYSA-N |
| XLogP | 7.58 |
| TPSA | 93.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.04 |
| LogP ≤ 5 | 7.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|