C28H41N4O7P — CID 173148292
azane;[3,10-dihydroxy-6-oxo-5-(3,7,11-trimethyldodeca-2,6,10-trienyl)-11H-benzo[b][1,4]benzodiazepin-1-yl] dihydrogen phosphate (PubChem CID 173148292) has the molecular formula C28H41N4O7P and a molecular weight of 576.63 g/mol. Its IUPAC name is azane;[3,10-dihydroxy-6-oxo-5-(3,7,11-trimethyldodeca-2,6,10-trienyl)-11H-benzo[b][1,4]benzodiazepin-1-yl] dihydrogen phosphate.
| Compound Name | azane;[3,10-dihydroxy-6-oxo-5-(3,7,11-trimethyldodeca-2,6,10-trienyl)-11H-benzo[b][1,4]benzodiazepin-1-yl] dihydrogen phosphate |
|---|---|
| PubChem CID | 173148292 |
| Molecular Formula | C28H41N4O7P |
| Molecular Weight | 576.63 g/mol |
| Exact Mass | 576.27 |
| IUPAC Name | azane;[3,10-dihydroxy-6-oxo-5-(3,7,11-trimethyldodeca-2,6,10-trienyl)-11H-benzo[b][1,4]benzodiazepin-1-yl] dihydrogen phosphate |
| SMILES | CC(C)=CCCC(C)=CCCC(C)=CCN1C(=O)c2cccc(O)c2Nc2c(OP(=O)(O)O)cc(O)cc21.N.N |
| InChI | InChI=1S/C28H35N2O7P.2H3N/c1-18(2)8-5-9-19(3)10-6-11-20(4)14-15-30-23-16-21(31)17-25(37-38(34,35)36)27(23)29-26-22(28(30)33)12-7-13-24(26)32;;/h7-8,10,12-14,16-17,29,31-32H,5-6,9,11,15H2,1-4H3,(H2,34,35,36);2*1H3 |
| InChIKey | HLEXLKWEXGXQDT-UHFFFAOYSA-N |
| XLogP | 7.02 |
| TPSA | 209.56 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.63 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|