C28H36N2O6 — CID 91547659
5-(6,7-dihydroxy-3,7,11-trimethyldodeca-2,10-dienyl)-1,3,10-trihydroxy-11H-benzo[b][1,4]benzodiazepin-6-one (PubChem CID 91547659) has the molecular formula C28H36N2O6 and a molecular weight of 496.60 g/mol. Its IUPAC name is 5-(6,7-dihydroxy-3,7,11-trimethyldodeca-2,10-dienyl)-1,3,10-trihydroxy-11H-benzo[b][1,4]benzodiazepin-6-one.
| Compound Name | 5-(6,7-dihydroxy-3,7,11-trimethyldodeca-2,10-dienyl)-1,3,10-trihydroxy-11H-benzo[b][1,4]benzodiazepin-6-one |
|---|---|
| PubChem CID | 91547659 |
| Molecular Formula | C28H36N2O6 |
| Molecular Weight | 496.60 g/mol |
| Exact Mass | 496.26 |
| IUPAC Name | 5-(6,7-dihydroxy-3,7,11-trimethyldodeca-2,10-dienyl)-1,3,10-trihydroxy-11H-benzo[b][1,4]benzodiazepin-6-one |
| SMILES | CC(C)=CCCC(C)(O)C(O)CCC(C)=CCN1C(=O)c2cccc(O)c2Nc2c(O)cc(O)cc21 |
| InChI | InChI=1S/C28H36N2O6/c1-17(2)7-6-13-28(4,36)24(34)11-10-18(3)12-14-30-21-15-19(31)16-23(33)26(21)29-25-20(27(30)35)8-5-9-22(25)32/h5,7-9,12,15-16,24,29,31-34,36H,6,10-11,13-14H2,1-4H3 |
| InChIKey | WUGFKQOAXMYHNO-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 133.49 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.60 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|