C28H35N2O7P — CID 69213529
[1,3-dihydroxy-6-oxo-5-(3,7,11-trimethyldodeca-2,6,10-trienyl)-11H-benzo[b][1,4]benzodiazepin-10-yl] dihydrogen phosphate (PubChem CID 69213529) has the molecular formula C28H35N2O7P and a molecular weight of 542.57 g/mol. Its IUPAC name is [1,3-dihydroxy-6-oxo-5-(3,7,11-trimethyldodeca-2,6,10-trienyl)-11H-benzo[b][1,4]benzodiazepin-10-yl] dihydrogen phosphate.
| Compound Name | [1,3-dihydroxy-6-oxo-5-(3,7,11-trimethyldodeca-2,6,10-trienyl)-11H-benzo[b][1,4]benzodiazepin-10-yl] dihydrogen phosphate |
|---|---|
| PubChem CID | 69213529 |
| Molecular Formula | C28H35N2O7P |
| Molecular Weight | 542.57 g/mol |
| Exact Mass | 542.22 |
| IUPAC Name | [1,3-dihydroxy-6-oxo-5-(3,7,11-trimethyldodeca-2,6,10-trienyl)-11H-benzo[b][1,4]benzodiazepin-10-yl] dihydrogen phosphate |
| SMILES | CC(C)=CCCC(C)=CCCC(C)=CCN1C(=O)c2cccc(OP(=O)(O)O)c2Nc2c(O)cc(O)cc21 |
| InChI | InChI=1S/C28H35N2O7P/c1-18(2)8-5-9-19(3)10-6-11-20(4)14-15-30-23-16-21(31)17-24(32)27(23)29-26-22(28(30)33)12-7-13-25(26)37-38(34,35)36/h7-8,10,12-14,16-17,29,31-32H,5-6,9,11,15H2,1-4H3,(H2,34,35,36) |
| InChIKey | VATXNUITVCQFCT-UHFFFAOYSA-N |
| XLogP | 6.69 |
| TPSA | 139.56 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.57 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|