C31H38N2O5 — CID 143873527
[1,10-dihydroxy-6-oxo-5-[(2E,7E)-3,8,12-trimethyltrideca-2,7,11-trienyl]-11H-benzo[b][1,4]benzodiazepin-3-yl] acetate (PubChem CID 143873527) has the molecular formula C31H38N2O5 and a molecular weight of 518.65 g/mol. Its IUPAC name is [1,10-dihydroxy-6-oxo-5-[(2E,7E)-3,8,12-trimethyltrideca-2,7,11-trienyl]-11H-benzo[b][1,4]benzodiazepin-3-yl] acetate.
| Compound Name | [1,10-dihydroxy-6-oxo-5-[(2E,7E)-3,8,12-trimethyltrideca-2,7,11-trienyl]-11H-benzo[b][1,4]benzodiazepin-3-yl] acetate |
|---|---|
| PubChem CID | 143873527 |
| Molecular Formula | C31H38N2O5 |
| Molecular Weight | 518.65 g/mol |
| Exact Mass | 518.28 |
| IUPAC Name | [1,10-dihydroxy-6-oxo-5-[(2E,7E)-3,8,12-trimethyltrideca-2,7,11-trienyl]-11H-benzo[b][1,4]benzodiazepin-3-yl] acetate |
| SMILES | CC(=O)Oc1cc(O)c2c(c1)N(C/C=C(\C)CCC/C=C(\C)CCC=C(C)C)C(=O)c1cccc(O)c1N2 |
| InChI | InChI=1S/C31H38N2O5/c1-20(2)10-8-13-21(3)11-6-7-12-22(4)16-17-33-26-18-24(38-23(5)34)19-28(36)30(26)32-29-25(31(33)37)14-9-15-27(29)35/h9-11,14-16,18-19,32,35-36H,6-8,12-13,17H2,1-5H3/b21-11+,22-16+ |
| InChIKey | OZHZLXVWFUBHBQ-ZDHFGRQBSA-N |
| XLogP | 7.54 |
| TPSA | 99.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.65 |
| LogP ≤ 5 | 7.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|