C30H38N2O4 — CID 10345475
1-hydroxy-3,10-dimethoxy-5-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]-11H-benzo[b][1,4]benzodiazepin-6-one (PubChem CID 10345475) has the molecular formula C30H38N2O4 and a molecular weight of 490.64 g/mol. Its IUPAC name is 1-hydroxy-3,10-dimethoxy-5-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]-11H-benzo[b][1,4]benzodiazepin-6-one.
| Compound Name | 1-hydroxy-3,10-dimethoxy-5-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]-11H-benzo[b][1,4]benzodiazepin-6-one |
|---|---|
| PubChem CID | 10345475 |
| Molecular Formula | C30H38N2O4 |
| Molecular Weight | 490.64 g/mol |
| Exact Mass | 490.28 |
| IUPAC Name | 1-hydroxy-3,10-dimethoxy-5-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]-11H-benzo[b][1,4]benzodiazepin-6-one |
| SMILES | COc1cc(O)c2c(c1)N(C/C=C(\C)CC/C=C(\C)CCC=C(C)C)C(=O)c1cccc(OC)c1N2 |
| InChI | InChI=1S/C30H38N2O4/c1-20(2)10-7-11-21(3)12-8-13-22(4)16-17-32-25-18-23(35-5)19-26(33)29(25)31-28-24(30(32)34)14-9-15-27(28)36-6/h9-10,12,14-16,18-19,31,33H,7-8,11,13,17H2,1-6H3/b21-12+,22-16+ |
| InChIKey | SETKLTPDDSFXLV-PMPJFHHKSA-N |
| XLogP | 7.53 |
| TPSA | 71.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.64 |
| LogP ≤ 5 | 7.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|