C30H38N2O3 — CID 91123674
3-hydroxy-10-methoxy-1-methyl-5-(3,7,11-trimethyldodeca-2,6,10-trienyl)-11H-benzo[b][1,4]benzodiazepin-6-one (PubChem CID 91123674) has the molecular formula C30H38N2O3 and a molecular weight of 474.65 g/mol. Its IUPAC name is 3-hydroxy-10-methoxy-1-methyl-5-(3,7,11-trimethyldodeca-2,6,10-trienyl)-11H-benzo[b][1,4]benzodiazepin-6-one.
| Compound Name | 3-hydroxy-10-methoxy-1-methyl-5-(3,7,11-trimethyldodeca-2,6,10-trienyl)-11H-benzo[b][1,4]benzodiazepin-6-one |
|---|---|
| PubChem CID | 91123674 |
| Molecular Formula | C30H38N2O3 |
| Molecular Weight | 474.65 g/mol |
| Exact Mass | 474.29 |
| IUPAC Name | 3-hydroxy-10-methoxy-1-methyl-5-(3,7,11-trimethyldodeca-2,6,10-trienyl)-11H-benzo[b][1,4]benzodiazepin-6-one |
| SMILES | COc1cccc2c1Nc1c(C)cc(O)cc1N(CC=C(C)CCC=C(C)CCC=C(C)C)C2=O |
| InChI | InChI=1S/C30H38N2O3/c1-20(2)10-7-11-21(3)12-8-13-22(4)16-17-32-26-19-24(33)18-23(5)28(26)31-29-25(30(32)34)14-9-15-27(29)35-6/h9-10,12,14-16,18-19,31,33H,7-8,11,13,17H2,1-6H3 |
| InChIKey | LOLCFRMJZYTUIV-UHFFFAOYSA-N |
| XLogP | 7.83 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.65 |
| LogP ≤ 5 | 7.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|