C28H33Br3N2O4 — CID 59164318
2-bromo-5-[(2E)-6,7-dibromo-3,7,11-trimethyldodeca-2,10-dienyl]-1,3,10-trihydroxy-11H-benzo[b][1,4]benzodiazepin-6-one (PubChem CID 59164318) has the molecular formula C28H33Br3N2O4 and a molecular weight of 701.29 g/mol. Its IUPAC name is 2-bromo-5-[(2E)-6,7-dibromo-3,7,11-trimethyldodeca-2,10-dienyl]-1,3,10-trihydroxy-11H-benzo[b][1,4]benzodiazepin-6-one.
| Compound Name | 2-bromo-5-[(2E)-6,7-dibromo-3,7,11-trimethyldodeca-2,10-dienyl]-1,3,10-trihydroxy-11H-benzo[b][1,4]benzodiazepin-6-one |
|---|---|
| PubChem CID | 59164318 |
| Molecular Formula | C28H33Br3N2O4 |
| Molecular Weight | 701.29 g/mol |
| Exact Mass | 698.00 |
| IUPAC Name | 2-bromo-5-[(2E)-6,7-dibromo-3,7,11-trimethyldodeca-2,10-dienyl]-1,3,10-trihydroxy-11H-benzo[b][1,4]benzodiazepin-6-one |
| SMILES | CC(C)=CCCC(C)(Br)C(Br)CC/C(C)=C/CN1C(=O)c2cccc(O)c2Nc2c1cc(O)c(Br)c2O |
| InChI | InChI=1S/C28H33Br3N2O4/c1-16(2)7-6-13-28(4,31)22(29)11-10-17(3)12-14-33-19-15-21(35)23(30)26(36)25(19)32-24-18(27(33)37)8-5-9-20(24)34/h5,7-9,12,15,22,32,34-36H,6,10-11,13-14H2,1-4H3/b17-12+ |
| InChIKey | TUIUWZAJQVLVQY-SFQUDFHCSA-N |
| XLogP | 8.66 |
| TPSA | 93.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 701.29 |
| LogP ≤ 5 | 8.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|