C29H35BN2O4 — CID 89143390
CID 89143390 (PubChem CID 89143390) has the molecular formula C29H35BN2O4 and a molecular weight of 486.42 g/mol.
| Compound Name | CID 89143390 |
|---|---|
| PubChem CID | 89143390 |
| Molecular Formula | C29H35BN2O4 |
| Molecular Weight | 486.42 g/mol |
| Exact Mass | 486.27 |
| IUPAC Name | — |
| SMILES | [B]c1c(O)cc2c(c1O)N(C)c1c(O)cccc1C(=O)N2C/C=C(\C)CC/C=C(\C)CCC=C(C)C |
| InChI | InChI=1S/C29H35BN2O4/c1-18(2)9-6-10-19(3)11-7-12-20(4)15-16-32-22-17-24(34)25(30)28(35)27(22)31(5)26-21(29(32)36)13-8-14-23(26)33/h8-9,11,13-15,17,33-35H,6-7,10,12,16H2,1-5H3/b19-11+,20-15+ |
| InChIKey | GMYYMQRNVHNRQF-NKFKFSAASA-N |
| XLogP | 5.74 |
| TPSA | 84.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.42 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|