C34H42N2O5 — CID 91486836
[1-acetyloxy-10,11-dimethyl-6-oxo-5-(3,7,11-trimethyldodeca-2,6,10-trienyl)benzo[b][1,4]benzodiazepin-3-yl] acetate (PubChem CID 91486836) has the molecular formula C34H42N2O5 and a molecular weight of 558.72 g/mol. Its IUPAC name is [1-acetyloxy-10,11-dimethyl-6-oxo-5-(3,7,11-trimethyldodeca-2,6,10-trienyl)benzo[b][1,4]benzodiazepin-3-yl] acetate.
| Compound Name | [1-acetyloxy-10,11-dimethyl-6-oxo-5-(3,7,11-trimethyldodeca-2,6,10-trienyl)benzo[b][1,4]benzodiazepin-3-yl] acetate |
|---|---|
| PubChem CID | 91486836 |
| Molecular Formula | C34H42N2O5 |
| Molecular Weight | 558.72 g/mol |
| Exact Mass | 558.31 |
| IUPAC Name | [1-acetyloxy-10,11-dimethyl-6-oxo-5-(3,7,11-trimethyldodeca-2,6,10-trienyl)benzo[b][1,4]benzodiazepin-3-yl] acetate |
| SMILES | CC(=O)Oc1cc(OC(C)=O)c2c(c1)N(CC=C(C)CCC=C(C)CCC=C(C)C)C(=O)c1cccc(C)c1N2C |
| InChI | InChI=1S/C34H42N2O5/c1-22(2)12-9-13-23(3)14-10-15-24(4)18-19-36-30-20-28(40-26(6)37)21-31(41-27(7)38)33(30)35(8)32-25(5)16-11-17-29(32)34(36)39/h11-12,14,16-18,20-21H,9-10,13,15,19H2,1-8H3 |
| InChIKey | RWDAPIMCZHEWPM-UHFFFAOYSA-N |
| XLogP | 7.99 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.72 |
| LogP ≤ 5 | 7.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|