C30H41N2O13P3 — CID 87736477
[11-ethyl-6-oxo-1,3-diphosphonooxy-5-(3,7,11-trimethyldodeca-2,6,10-trienyl)benzo[b][1,4]benzodiazepin-10-yl] dihydrogen phosphate (PubChem CID 87736477) has the molecular formula C30H41N2O13P3 and a molecular weight of 730.58 g/mol. Its IUPAC name is [11-ethyl-6-oxo-1,3-diphosphonooxy-5-(3,7,11-trimethyldodeca-2,6,10-trienyl)benzo[b][1,4]benzodiazepin-10-yl] dihydrogen phosphate.
| Compound Name | [11-ethyl-6-oxo-1,3-diphosphonooxy-5-(3,7,11-trimethyldodeca-2,6,10-trienyl)benzo[b][1,4]benzodiazepin-10-yl] dihydrogen phosphate |
|---|---|
| PubChem CID | 87736477 |
| Molecular Formula | C30H41N2O13P3 |
| Molecular Weight | 730.58 g/mol |
| Exact Mass | 730.18 |
| IUPAC Name | [11-ethyl-6-oxo-1,3-diphosphonooxy-5-(3,7,11-trimethyldodeca-2,6,10-trienyl)benzo[b][1,4]benzodiazepin-10-yl] dihydrogen phosphate |
| SMILES | CCN1c2c(OP(=O)(O)O)cccc2C(=O)N(CC=C(C)CCC=C(C)CCC=C(C)C)c2cc(OP(=O)(O)O)cc(OP(=O)(O)O)c21 |
| InChI | InChI=1S/C30H41N2O13P3/c1-6-31-28-24(14-9-15-26(28)44-47(37,38)39)30(33)32(17-16-22(5)13-8-12-21(4)11-7-10-20(2)3)25-18-23(43-46(34,35)36)19-27(29(25)31)45-48(40,41)42/h9-10,12,14-16,18-19H,6-8,11,13,17H2,1-5H3,(H2,34,35,36)(H2,37,38,39)(H2,40,41,42) |
| InChIKey | SLAKJTQBWOBGNN-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 223.83 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 48 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 730.58 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|