C36H42N2O8 — CID 10349068
[11-acetyl-1,3-diacetyloxy-6-oxo-5-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]benzo[b][1,4]benzodiazepin-10-yl] acetate (PubChem CID 10349068) has the molecular formula C36H42N2O8 and a molecular weight of 630.74 g/mol. Its IUPAC name is [11-acetyl-1,3-diacetyloxy-6-oxo-5-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]benzo[b][1,4]benzodiazepin-10-yl] acetate.
| Compound Name | [11-acetyl-1,3-diacetyloxy-6-oxo-5-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]benzo[b][1,4]benzodiazepin-10-yl] acetate |
|---|---|
| PubChem CID | 10349068 |
| Molecular Formula | C36H42N2O8 |
| Molecular Weight | 630.74 g/mol |
| Exact Mass | 630.29 |
| IUPAC Name | [11-acetyl-1,3-diacetyloxy-6-oxo-5-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]benzo[b][1,4]benzodiazepin-10-yl] acetate |
| SMILES | CC(=O)Oc1cc(OC(C)=O)c2c(c1)N(C/C=C(\C)CC/C=C(\C)CCC=C(C)C)C(=O)c1cccc(OC(C)=O)c1N2C(C)=O |
| InChI | InChI=1S/C36H42N2O8/c1-22(2)12-9-13-23(3)14-10-15-24(4)18-19-37-31-20-29(44-26(6)40)21-33(46-28(8)42)35(31)38(25(5)39)34-30(36(37)43)16-11-17-32(34)45-27(7)41/h11-12,14,16-18,20-21H,9-10,13,15,19H2,1-8H3/b23-14+,24-18+ |
| InChIKey | RIKOVPMPEUEIBJ-WVDADPJUSA-N |
| XLogP | 7.53 |
| TPSA | 119.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.74 |
| LogP ≤ 5 | 7.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|