C33H44N2O4 — CID 11504723
1,3,10-trihydroxy-11-(2-methylbutyl)-5-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]benzo[b][1,4]benzodiazepin-6-one (PubChem CID 11504723) has the molecular formula C33H44N2O4 and a molecular weight of 532.73 g/mol. Its IUPAC name is 1,3,10-trihydroxy-11-(2-methylbutyl)-5-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]benzo[b][1,4]benzodiazepin-6-one.
| Compound Name | 1,3,10-trihydroxy-11-(2-methylbutyl)-5-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]benzo[b][1,4]benzodiazepin-6-one |
|---|---|
| PubChem CID | 11504723 |
| Molecular Formula | C33H44N2O4 |
| Molecular Weight | 532.73 g/mol |
| Exact Mass | 532.33 |
| IUPAC Name | 1,3,10-trihydroxy-11-(2-methylbutyl)-5-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]benzo[b][1,4]benzodiazepin-6-one |
| SMILES | CCC(C)CN1c2c(O)cccc2C(=O)N(C/C=C(\C)CC/C=C(\C)CCC=C(C)C)c2cc(O)cc(O)c21 |
| InChI | InChI=1S/C33H44N2O4/c1-7-23(4)21-35-31-27(15-10-16-29(31)37)33(39)34(28-19-26(36)20-30(38)32(28)35)18-17-25(6)14-9-13-24(5)12-8-11-22(2)3/h10-11,13,15-17,19-20,23,36-38H,7-9,12,14,18,21H2,1-6H3/b24-13+,25-17+ |
| InChIKey | IEENGZDWZWKAID-AGYLBUKUSA-N |
| XLogP | 8.37 |
| TPSA | 84.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.73 |
| LogP ≤ 5 | 8.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|