C31H42N2O5 — CID 68537537
11-ethyl-1,3,10-trihydroxy-5-[(2E,6E)-1-methoxy-3,7,11-trimethyldodeca-2,6-dienyl]benzo[b][1,4]benzodiazepin-6-one (PubChem CID 68537537) has the molecular formula C31H42N2O5 and a molecular weight of 522.69 g/mol. Its IUPAC name is 11-ethyl-1,3,10-trihydroxy-5-[(2E,6E)-1-methoxy-3,7,11-trimethyldodeca-2,6-dienyl]benzo[b][1,4]benzodiazepin-6-one.
| Compound Name | 11-ethyl-1,3,10-trihydroxy-5-[(2E,6E)-1-methoxy-3,7,11-trimethyldodeca-2,6-dienyl]benzo[b][1,4]benzodiazepin-6-one |
|---|---|
| PubChem CID | 68537537 |
| Molecular Formula | C31H42N2O5 |
| Molecular Weight | 522.69 g/mol |
| Exact Mass | 522.31 |
| IUPAC Name | 11-ethyl-1,3,10-trihydroxy-5-[(2E,6E)-1-methoxy-3,7,11-trimethyldodeca-2,6-dienyl]benzo[b][1,4]benzodiazepin-6-one |
| SMILES | CCN1c2c(O)cccc2C(=O)N(C(/C=C(\C)CC/C=C(\C)CCCC(C)C)OC)c2cc(O)cc(O)c21 |
| InChI | InChI=1S/C31H42N2O5/c1-7-32-29-24(15-10-16-26(29)35)31(37)33(25-18-23(34)19-27(36)30(25)32)28(38-6)17-22(5)14-9-13-21(4)12-8-11-20(2)3/h10,13,15-20,28,34-36H,7-9,11-12,14H2,1-6H3/b21-13+,22-17+ |
| InChIKey | WOXPZVYAOIJCRY-BRAPJGFWSA-N |
| XLogP | 7.39 |
| TPSA | 93.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.69 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|