C28H36N2O5 — CID 91103402
5-[[3-(4,8-dimethylnon-3-enyl)-3-methyloxiran-2-yl]methyl]-1,3,10-trihydroxy-11H-benzo[b][1,4]benzodiazepin-6-one (PubChem CID 91103402) has the molecular formula C28H36N2O5 and a molecular weight of 480.61 g/mol. Its IUPAC name is 5-[[3-(4,8-dimethylnon-3-enyl)-3-methyloxiran-2-yl]methyl]-1,3,10-trihydroxy-11H-benzo[b][1,4]benzodiazepin-6-one.
| Compound Name | 5-[[3-(4,8-dimethylnon-3-enyl)-3-methyloxiran-2-yl]methyl]-1,3,10-trihydroxy-11H-benzo[b][1,4]benzodiazepin-6-one |
|---|---|
| PubChem CID | 91103402 |
| Molecular Formula | C28H36N2O5 |
| Molecular Weight | 480.61 g/mol |
| Exact Mass | 480.26 |
| IUPAC Name | 5-[[3-(4,8-dimethylnon-3-enyl)-3-methyloxiran-2-yl]methyl]-1,3,10-trihydroxy-11H-benzo[b][1,4]benzodiazepin-6-one |
| SMILES | CC(=CCCC1(C)OC1CN1C(=O)c2cccc(O)c2Nc2c(O)cc(O)cc21)CCCC(C)C |
| InChI | InChI=1S/C28H36N2O5/c1-17(2)8-5-9-18(3)10-7-13-28(4)24(35-28)16-30-21-14-19(31)15-23(33)26(21)29-25-20(27(30)34)11-6-12-22(25)32/h6,10-12,14-15,17,24,29,31-33H,5,7-9,13,16H2,1-4H3 |
| InChIKey | ANLXFNXURPRMQN-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 105.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.61 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|