C28H38N2O4 — CID 10434707
1,3,10-trihydroxy-5-(3,7,11-trimethyldodec-10-enyl)-11H-benzo[b][1,4]benzodiazepin-6-one (PubChem CID 10434707) has the molecular formula C28H38N2O4 and a molecular weight of 466.62 g/mol. Its IUPAC name is 1,3,10-trihydroxy-5-(3,7,11-trimethyldodec-10-enyl)-11H-benzo[b][1,4]benzodiazepin-6-one.
| Compound Name | 1,3,10-trihydroxy-5-(3,7,11-trimethyldodec-10-enyl)-11H-benzo[b][1,4]benzodiazepin-6-one |
|---|---|
| PubChem CID | 10434707 |
| Molecular Formula | C28H38N2O4 |
| Molecular Weight | 466.62 g/mol |
| Exact Mass | 466.28 |
| IUPAC Name | 1,3,10-trihydroxy-5-(3,7,11-trimethyldodec-10-enyl)-11H-benzo[b][1,4]benzodiazepin-6-one |
| SMILES | CC(C)=CCCC(C)CCCC(C)CCN1C(=O)c2cccc(O)c2Nc2c(O)cc(O)cc21 |
| InChI | InChI=1S/C28H38N2O4/c1-18(2)8-5-9-19(3)10-6-11-20(4)14-15-30-23-16-21(31)17-25(33)27(23)29-26-22(28(30)34)12-7-13-24(26)32/h7-8,12-13,16-17,19-20,29,31-33H,5-6,9-11,14-15H2,1-4H3 |
| InChIKey | XGULAOBWPYEMKN-UHFFFAOYSA-N |
| XLogP | 7.09 |
| TPSA | 93.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.62 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|