C29H37NO5 — CID 166873373
1,3,10-trihydroxy-5-[3-methyl-5-[3-methyl-3-(4-methylpent-3-enyl)oxiran-2-yl]pentyl]-11H-benzo[c][1]benzazepin-6-one (PubChem CID 166873373) has the molecular formula C29H37NO5 and a molecular weight of 479.62 g/mol. Its IUPAC name is 1,3,10-trihydroxy-5-[3-methyl-5-[3-methyl-3-(4-methylpent-3-enyl)oxiran-2-yl]pentyl]-11H-benzo[c][1]benzazepin-6-one.
| Compound Name | 1,3,10-trihydroxy-5-[3-methyl-5-[3-methyl-3-(4-methylpent-3-enyl)oxiran-2-yl]pentyl]-11H-benzo[c][1]benzazepin-6-one |
|---|---|
| PubChem CID | 166873373 |
| Molecular Formula | C29H37NO5 |
| Molecular Weight | 479.62 g/mol |
| Exact Mass | 479.27 |
| IUPAC Name | 1,3,10-trihydroxy-5-[3-methyl-5-[3-methyl-3-(4-methylpent-3-enyl)oxiran-2-yl]pentyl]-11H-benzo[c][1]benzazepin-6-one |
| SMILES | CC(C)=CCCC1(C)OC1CCC(C)CCN1C(=O)c2cccc(O)c2Cc2c(O)cc(O)cc21 |
| InChI | InChI=1S/C29H37NO5/c1-18(2)7-6-13-29(4)27(35-29)11-10-19(3)12-14-30-24-15-20(31)16-26(33)23(24)17-22-21(28(30)34)8-5-9-25(22)32/h5,7-9,15-16,19,27,31-33H,6,10-14,17H2,1-4H3 |
| InChIKey | XOJBGGSMNBKPEN-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 93.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.62 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|