C23H31NO5 — CID 159229141
2-hydroxybutyl 2-(3,7-dimethyloct-6-enyl)-1,3-dioxoisoindole-5-carboxylate (PubChem CID 159229141) has the molecular formula C23H31NO5 and a molecular weight of 401.50 g/mol. Its IUPAC name is 2-hydroxybutyl 2-(3,7-dimethyloct-6-enyl)-1,3-dioxoisoindole-5-carboxylate.
| Compound Name | 2-hydroxybutyl 2-(3,7-dimethyloct-6-enyl)-1,3-dioxoisoindole-5-carboxylate |
|---|---|
| PubChem CID | 159229141 |
| Molecular Formula | C23H31NO5 |
| Molecular Weight | 401.50 g/mol |
| Exact Mass | 401.22 |
| IUPAC Name | 2-hydroxybutyl 2-(3,7-dimethyloct-6-enyl)-1,3-dioxoisoindole-5-carboxylate |
| SMILES | CCC(O)COC(=O)c1ccc2c(c1)C(=O)N(CCC(C)CCC=C(C)C)C2=O |
| InChI | InChI=1S/C23H31NO5/c1-5-18(25)14-29-23(28)17-9-10-19-20(13-17)22(27)24(21(19)26)12-11-16(4)8-6-7-15(2)3/h7,9-10,13,16,18,25H,5-6,8,11-12,14H2,1-4H3 |
| InChIKey | AXCUUMREKWYNOR-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.50 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|