C23H19NO6 — CID 170224683
2-hydroxybutyl 2-(6-hydroxynaphthalen-1-yl)-1,3-dioxoisoindole-5-carboxylate (PubChem CID 170224683) has the molecular formula C23H19NO6 and a molecular weight of 405.41 g/mol. Its IUPAC name is 2-hydroxybutyl 2-(6-hydroxynaphthalen-1-yl)-1,3-dioxoisoindole-5-carboxylate.
| Compound Name | 2-hydroxybutyl 2-(6-hydroxynaphthalen-1-yl)-1,3-dioxoisoindole-5-carboxylate |
|---|---|
| PubChem CID | 170224683 |
| Molecular Formula | C23H19NO6 |
| Molecular Weight | 405.41 g/mol |
| Exact Mass | 405.12 |
| IUPAC Name | 2-hydroxybutyl 2-(6-hydroxynaphthalen-1-yl)-1,3-dioxoisoindole-5-carboxylate |
| SMILES | CCC(O)COC(=O)c1ccc2c(c1)C(=O)N(c1cccc3cc(O)ccc13)C2=O |
| InChI | InChI=1S/C23H19NO6/c1-2-15(25)12-30-23(29)14-6-8-18-19(11-14)22(28)24(21(18)27)20-5-3-4-13-10-16(26)7-9-17(13)20/h3-11,15,25-26H,2,12H2,1H3 |
| InChIKey | IOAVKQOOWBUELK-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 104.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.41 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|