C23H21NO6 — CID 170224774
2-hydroxybutyl 2-(2-methyl-3-prop-2-ynoxyphenyl)-1,3-dioxoisoindole-5-carboxylate (PubChem CID 170224774) has the molecular formula C23H21NO6 and a molecular weight of 407.42 g/mol. Its IUPAC name is 2-hydroxybutyl 2-(2-methyl-3-prop-2-ynoxyphenyl)-1,3-dioxoisoindole-5-carboxylate.
| Compound Name | 2-hydroxybutyl 2-(2-methyl-3-prop-2-ynoxyphenyl)-1,3-dioxoisoindole-5-carboxylate |
|---|---|
| PubChem CID | 170224774 |
| Molecular Formula | C23H21NO6 |
| Molecular Weight | 407.42 g/mol |
| Exact Mass | 407.14 |
| IUPAC Name | 2-hydroxybutyl 2-(2-methyl-3-prop-2-ynoxyphenyl)-1,3-dioxoisoindole-5-carboxylate |
| SMILES | C#CCOc1cccc(N2C(=O)c3ccc(C(=O)OCC(O)CC)cc3C2=O)c1C |
| InChI | InChI=1S/C23H21NO6/c1-4-11-29-20-8-6-7-19(14(20)3)24-21(26)17-10-9-15(12-18(17)22(24)27)23(28)30-13-16(25)5-2/h1,6-10,12,16,25H,5,11,13H2,2-3H3 |
| InChIKey | UMGCHAUIYDHDGS-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.42 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|