C23H23NO7 — CID 170224702
2-hydroxybutyl 2-(3-methoxy-4-prop-2-enoxyphenyl)-1,3-dioxoisoindole-5-carboxylate (PubChem CID 170224702) has the molecular formula C23H23NO7 and a molecular weight of 425.44 g/mol. Its IUPAC name is 2-hydroxybutyl 2-(3-methoxy-4-prop-2-enoxyphenyl)-1,3-dioxoisoindole-5-carboxylate.
| Compound Name | 2-hydroxybutyl 2-(3-methoxy-4-prop-2-enoxyphenyl)-1,3-dioxoisoindole-5-carboxylate |
|---|---|
| PubChem CID | 170224702 |
| Molecular Formula | C23H23NO7 |
| Molecular Weight | 425.44 g/mol |
| Exact Mass | 425.15 |
| IUPAC Name | 2-hydroxybutyl 2-(3-methoxy-4-prop-2-enoxyphenyl)-1,3-dioxoisoindole-5-carboxylate |
| SMILES | C=CCOc1ccc(N2C(=O)c3ccc(C(=O)OCC(O)CC)cc3C2=O)cc1OC |
| InChI | InChI=1S/C23H23NO7/c1-4-10-30-19-9-7-15(12-20(19)29-3)24-21(26)17-8-6-14(11-18(17)22(24)27)23(28)31-13-16(25)5-2/h4,6-9,11-12,16,25H,1,5,10,13H2,2-3H3 |
| InChIKey | LSVBHEQQCUUEAR-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 102.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.44 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|