C22H21NO6 — CID 170224697
2-hydroxybutyl 1,3-dioxo-2-(4-prop-2-enoxyphenyl)isoindole-5-carboxylate (PubChem CID 170224697) has the molecular formula C22H21NO6 and a molecular weight of 395.41 g/mol. Its IUPAC name is 2-hydroxybutyl 1,3-dioxo-2-(4-prop-2-enoxyphenyl)isoindole-5-carboxylate.
| Compound Name | 2-hydroxybutyl 1,3-dioxo-2-(4-prop-2-enoxyphenyl)isoindole-5-carboxylate |
|---|---|
| PubChem CID | 170224697 |
| Molecular Formula | C22H21NO6 |
| Molecular Weight | 395.41 g/mol |
| Exact Mass | 395.14 |
| IUPAC Name | 2-hydroxybutyl 1,3-dioxo-2-(4-prop-2-enoxyphenyl)isoindole-5-carboxylate |
| SMILES | C=CCOc1ccc(N2C(=O)c3ccc(C(=O)OCC(O)CC)cc3C2=O)cc1 |
| InChI | InChI=1S/C22H21NO6/c1-3-11-28-17-8-6-15(7-9-17)23-20(25)18-10-5-14(12-19(18)21(23)26)22(27)29-13-16(24)4-2/h3,5-10,12,16,24H,1,4,11,13H2,2H3 |
| InChIKey | HOLOHKOVXCUVQI-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.41 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|