C26H29NO6 — CID 5056605
pentyl 1,3-dioxo-2-(4-pentoxycarbonylphenyl)isoindole-5-carboxylate (PubChem CID 5056605) has the molecular formula C26H29NO6 and a molecular weight of 451.52 g/mol. Its IUPAC name is pentyl 1,3-dioxo-2-(4-pentoxycarbonylphenyl)isoindole-5-carboxylate.
| Compound Name | pentyl 1,3-dioxo-2-(4-pentoxycarbonylphenyl)isoindole-5-carboxylate |
|---|---|
| PubChem CID | 5056605 |
| Molecular Formula | C26H29NO6 |
| Molecular Weight | 451.52 g/mol |
| Exact Mass | 451.20 |
| IUPAC Name | pentyl 1,3-dioxo-2-(4-pentoxycarbonylphenyl)isoindole-5-carboxylate |
| SMILES | CCCCCOC(=O)c1ccc(N2C(=O)c3ccc(C(=O)OCCCCC)cc3C2=O)cc1 |
| InChI | InChI=1S/C26H29NO6/c1-3-5-7-15-32-25(30)18-9-12-20(13-10-18)27-23(28)21-14-11-19(17-22(21)24(27)29)26(31)33-16-8-6-4-2/h9-14,17H,3-8,15-16H2,1-2H3 |
| InChIKey | GHLLJDWKQJOQOI-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.52 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|