C36H30N2O8 — CID 3119628
butyl 4-[13-(4-butoxycarbonylphenyl)-5,7,12,14-tetraoxo-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),8,10-pentaen-6-yl]benzoate (PubChem CID 3119628) has the molecular formula C36H30N2O8 and a molecular weight of 618.64 g/mol. Its IUPAC name is butyl 4-[13-(4-butoxycarbonylphenyl)-5,7,12,14-tetraoxo-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),8,10-pentaen-6-yl]benzoate.
| Compound Name | butyl 4-[13-(4-butoxycarbonylphenyl)-5,7,12,14-tetraoxo-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),8,10-pentaen-6-yl]benzoate |
|---|---|
| PubChem CID | 3119628 |
| Molecular Formula | C36H30N2O8 |
| Molecular Weight | 618.64 g/mol |
| Exact Mass | 618.20 |
| IUPAC Name | butyl 4-[13-(4-butoxycarbonylphenyl)-5,7,12,14-tetraoxo-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),8,10-pentaen-6-yl]benzoate |
| SMILES | CCCCOC(=O)c1ccc(N2C(=O)c3ccc4c5c(ccc(c35)C2=O)C(=O)N(c2ccc(C(=O)OCCCC)cc2)C4=O)cc1 |
| InChI | InChI=1S/C36H30N2O8/c1-3-5-19-45-35(43)21-7-11-23(12-8-21)37-31(39)25-15-17-27-30-28(18-16-26(29(25)30)32(37)40)34(42)38(33(27)41)24-13-9-22(10-14-24)36(44)46-20-6-4-2/h7-18H,3-6,19-20H2,1-2H3 |
| InChIKey | XICNCPDTISTDGH-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 127.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.64 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|