C22H22BrNO4 — CID 3094542
heptyl 4-(5-bromo-1,3-dioxoisoindol-2-yl)benzoate (PubChem CID 3094542) has the molecular formula C22H22BrNO4 and a molecular weight of 444.33 g/mol. Its IUPAC name is heptyl 4-(5-bromo-1,3-dioxoisoindol-2-yl)benzoate.
| Compound Name | heptyl 4-(5-bromo-1,3-dioxoisoindol-2-yl)benzoate |
|---|---|
| PubChem CID | 3094542 |
| Molecular Formula | C22H22BrNO4 |
| Molecular Weight | 444.33 g/mol |
| Exact Mass | 443.07 |
| IUPAC Name | heptyl 4-(5-bromo-1,3-dioxoisoindol-2-yl)benzoate |
| SMILES | CCCCCCCOC(=O)c1ccc(N2C(=O)c3ccc(Br)cc3C2=O)cc1 |
| InChI | InChI=1S/C22H22BrNO4/c1-2-3-4-5-6-13-28-22(27)15-7-10-17(11-8-15)24-20(25)18-12-9-16(23)14-19(18)21(24)26/h7-12,14H,2-6,13H2,1H3 |
| InChIKey | LNBPNFPHPLKJNI-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.33 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|