C23H19NO4 — CID 3099109
butyl 2-naphthalen-2-yl-1,3-dioxoisoindole-5-carboxylate (PubChem CID 3099109) has the molecular formula C23H19NO4 and a molecular weight of 373.41 g/mol. Its IUPAC name is butyl 2-naphthalen-2-yl-1,3-dioxoisoindole-5-carboxylate.
| Compound Name | butyl 2-naphthalen-2-yl-1,3-dioxoisoindole-5-carboxylate |
|---|---|
| PubChem CID | 3099109 |
| Molecular Formula | C23H19NO4 |
| Molecular Weight | 373.41 g/mol |
| Exact Mass | 373.13 |
| IUPAC Name | butyl 2-naphthalen-2-yl-1,3-dioxoisoindole-5-carboxylate |
| SMILES | CCCCOC(=O)c1ccc2c(c1)C(=O)N(c1ccc3ccccc3c1)C2=O |
| InChI | InChI=1S/C23H19NO4/c1-2-3-12-28-23(27)17-9-11-19-20(14-17)22(26)24(21(19)25)18-10-8-15-6-4-5-7-16(15)13-18/h4-11,13-14H,2-3,12H2,1H3 |
| InChIKey | HYYHQNBUQSCFPJ-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.41 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|